![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| what time is it - scrolly.sndh | 2006-03-01 19:34 | 1.7K | |
| poppycock - stars.sndh | 2006-03-01 19:34 | 1.8K | |
| poppycock - sprites.sndh | 2006-03-01 19:34 | 2.1K | |
| pym - loader.sndh | 2006-03-01 19:34 | 2.2K | |
| offbeat.sndh | 2006-03-01 19:34 | 2.2K | |
| poppycock - intro.sndh | 2006-03-01 19:34 | 2.2K | |
| what time is it - bouncy.sndh | 2006-03-01 19:34 | 2.4K | |
| feardrop.sndh | 2006-03-01 19:34 | 2.4K | |
| structure.sndh | 2006-03-01 19:34 | 2.4K | |
| pym - main menu.sndh | 2006-03-01 19:34 | 2.5K | |
| a case for two.sndh | 2006-03-01 19:34 | 2.5K | |
| wicked.sndh | 2006-03-01 19:34 | 2.5K | |
| pym - intro (prime time).sndh | 2006-03-01 19:34 | 2.6K | |
| killer.sndh | 2006-03-01 19:34 | 2.6K | |
| pym - best part of creation.sndh | 2006-03-01 19:34 | 2.7K | |
| pym - isido way of stones.sndh | 2006-03-01 19:34 | 2.7K | |
| pym - colours go bang.sndh | 2006-03-01 19:34 | 2.7K | |
| pym - sickest so far.sndh | 2006-03-01 19:34 | 2.7K | |
| traffic.sndh | 2006-03-01 19:34 | 2.8K | |
| crystal clear (mega leif).sndh | 2006-03-01 19:34 | 2.9K | |
| pym - change disks.sndh | 2006-03-01 19:34 | 2.9K | |
| musical wonder.sndh | 2006-03-01 19:34 | 3.0K | |
| sanxion loader.sndh | 2006-03-01 19:34 | 3.0K | |
| pym - copperkaahbaahnaah.sndh | 2006-03-01 19:34 | 3.1K | |
| twilight beyond.sndh | 2006-03-01 19:34 | 3.3K | |
| stand by.sndh | 2006-03-01 19:34 | 3.4K | |
| judgement day (st news 7.2).sndh | 2006-03-01 19:34 | 3.7K | |
| killer digi.sndh | 2006-03-01 19:34 | 4.0K | |
| sanxion loader digi.sndh | 2006-03-01 19:34 | 5.2K | |
| high gear.sndh | 2006-03-01 19:34 | 5.4K | |
| jazz.sndh | 2006-03-01 19:34 | 5.5K | |
| magick.sndh | 2006-03-01 19:34 | 5.6K | |
| vortex.sndh | 2006-03-01 19:34 | 5.8K | |
| action.sndh | 2006-03-01 19:34 | 5.8K | |
| melancho.sndh | 2006-03-01 19:34 | 6.0K | |
| pursuit 2.sndh | 2006-03-01 19:34 | 6.1K | |
| bangkok knights loader.sndh | 2006-03-01 19:34 | 6.2K | |
| pursuit.sndh | 2006-03-01 19:34 | 6.2K | |
| what time is it - main menu.sndh | 2006-03-01 19:34 | 6.3K | |
| sticks.sndh | 2006-03-01 19:34 | 6.3K | |
| galaxy.sndh | 2006-03-01 19:34 | 6.5K | |
| reality.sndh | 2006-03-01 19:34 | 7.2K | |
| locomotion.sndh | 2006-03-01 19:34 | 7.9K | |
| no second prize.sndh | 2006-03-01 19:34 | 11K | |
| prophecy (st news 11.1).sndh | 2006-03-01 19:34 | 11K | |